C20H13F5N4O2 — CID 137101591
3,4-difluoro-N-[N'-(6-oxo-1H-pyridin-2-yl)-N-[3-(trifluoromethyl)phenyl]carbamimidoyl]benzamide (PubChem CID 137101591) has the molecular formula C20H13F5N4O2 and a molecular weight of 436.34 g/mol. Its IUPAC name is 3,4-difluoro-N-[N'-(6-oxo-1H-pyridin-2-yl)-N-[3-(trifluoromethyl)phenyl]carbamimidoyl]benzamide.
| Compound Name | 3,4-difluoro-N-[N'-(6-oxo-1H-pyridin-2-yl)-N-[3-(trifluoromethyl)phenyl]carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 137101591 |
| Molecular Formula | C20H13F5N4O2 |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 3,4-difluoro-N-[N'-(6-oxo-1H-pyridin-2-yl)-N-[3-(trifluoromethyl)phenyl]carbamimidoyl]benzamide |
| SMILES | O=C(NC(=Nc1cccc(=O)[nH]1)Nc1cccc(C(F)(F)F)c1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H13F5N4O2/c21-14-8-7-11(9-15(14)22)18(31)29-19(28-16-5-2-6-17(30)27-16)26-13-4-1-3-12(10-13)20(23,24)25/h1-10H,(H3,26,27,28,29,30,31) |
| InChIKey | JOOQKJLJDXMZGU-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|