C25H27F5N4O3 — CID 67967023
ethyl N-[4-[[N-(3,4-difluorobenzoyl)-N'-[[4-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]cyclohexyl]carbamate (PubChem CID 67967023) has the molecular formula C25H27F5N4O3 and a molecular weight of 526.51 g/mol. Its IUPAC name is ethyl N-[4-[[N-(3,4-difluorobenzoyl)-N'-[[4-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]cyclohexyl]carbamate.
| Compound Name | ethyl N-[4-[[N-(3,4-difluorobenzoyl)-N'-[[4-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 67967023 |
| Molecular Formula | C25H27F5N4O3 |
| Molecular Weight | 526.51 g/mol |
| Exact Mass | 526.20 |
| IUPAC Name | ethyl N-[4-[[N-(3,4-difluorobenzoyl)-N'-[[4-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]cyclohexyl]carbamate |
| SMILES | CCOC(=O)NC1CCC(N/C(=N/Cc2ccc(C(F)(F)F)cc2)NC(=O)c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C25H27F5N4O3/c1-2-37-24(36)33-19-10-8-18(9-11-19)32-23(34-22(35)16-5-12-20(26)21(27)13-16)31-14-15-3-6-17(7-4-15)25(28,29)30/h3-7,12-13,18-19H,2,8-11,14H2,1H3,(H,33,36)(H2,31,32,34,35) |
| InChIKey | YMPHMQZZCCCQIB-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.51 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|