C17H21F2N3O3S — CID 118472993
ethyl N-[4-[(3,4-difluorobenzoyl)carbamothioylamino]cyclohexyl]carbamate (PubChem CID 118472993) has the molecular formula C17H21F2N3O3S and a molecular weight of 385.44 g/mol. Its IUPAC name is ethyl N-[4-[(3,4-difluorobenzoyl)carbamothioylamino]cyclohexyl]carbamate.
| Compound Name | ethyl N-[4-[(3,4-difluorobenzoyl)carbamothioylamino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 118472993 |
| Molecular Formula | C17H21F2N3O3S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | ethyl N-[4-[(3,4-difluorobenzoyl)carbamothioylamino]cyclohexyl]carbamate |
| SMILES | CCOC(=O)NC1CCC(NC(=S)NC(=O)c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C17H21F2N3O3S/c1-2-25-17(24)21-12-6-4-11(5-7-12)20-16(26)22-15(23)10-3-8-13(18)14(19)9-10/h3,8-9,11-12H,2,4-7H2,1H3,(H,21,24)(H2,20,22,23,26) |
| InChIKey | AEKDFWFKFVBGKO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|