C19H25F2N3O3 — CID 70692025
ethyl (1R,5S)-3-[2-[(3,4-difluorobenzoyl)amino]ethylamino]-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 70692025) has the molecular formula C19H25F2N3O3 and a molecular weight of 381.42 g/mol. Its IUPAC name is ethyl (1R,5S)-3-[2-[(3,4-difluorobenzoyl)amino]ethylamino]-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | ethyl (1R,5S)-3-[2-[(3,4-difluorobenzoyl)amino]ethylamino]-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 70692025 |
| Molecular Formula | C19H25F2N3O3 |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | ethyl (1R,5S)-3-[2-[(3,4-difluorobenzoyl)amino]ethylamino]-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CCOC(=O)N1[C@@H]2CC[C@H]1CC(NCCNC(=O)c1ccc(F)c(F)c1)C2 |
| InChI | InChI=1S/C19H25F2N3O3/c1-2-27-19(26)24-14-4-5-15(24)11-13(10-14)22-7-8-23-18(25)12-3-6-16(20)17(21)9-12/h3,6,9,13-15,22H,2,4-5,7-8,10-11H2,1H3,(H,23,25)/t13?,14-,15+ |
| InChIKey | CTNFAGQKYUQNFA-GOOCMWNKSA-N |
| XLogP | 2.44 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|