C21H26F4N2O3 — CID 58346860
ethyl 3-[3-[[4-fluoro-3-(trifluoromethyl)benzoyl]amino]propyl]-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 58346860) has the molecular formula C21H26F4N2O3 and a molecular weight of 430.44 g/mol. Its IUPAC name is ethyl 3-[3-[[4-fluoro-3-(trifluoromethyl)benzoyl]amino]propyl]-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | ethyl 3-[3-[[4-fluoro-3-(trifluoromethyl)benzoyl]amino]propyl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 58346860 |
| Molecular Formula | C21H26F4N2O3 |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | ethyl 3-[3-[[4-fluoro-3-(trifluoromethyl)benzoyl]amino]propyl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CCOC(=O)N1C2CCC1CC(CCCNC(=O)c1ccc(F)c(C(F)(F)F)c1)C2 |
| InChI | InChI=1S/C21H26F4N2O3/c1-2-30-20(29)27-15-6-7-16(27)11-13(10-15)4-3-9-26-19(28)14-5-8-18(22)17(12-14)21(23,24)25/h5,8,12-13,15-16H,2-4,6-7,9-11H2,1H3,(H,26,28) |
| InChIKey | ZQTXETCBYSDHBP-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|