C20H26ClFN2O3 — CID 58346854
ethyl 3-[3-[(2-chloro-4-fluorobenzoyl)amino]propyl]-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 58346854) has the molecular formula C20H26ClFN2O3 and a molecular weight of 396.89 g/mol. Its IUPAC name is ethyl 3-[3-[(2-chloro-4-fluorobenzoyl)amino]propyl]-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | ethyl 3-[3-[(2-chloro-4-fluorobenzoyl)amino]propyl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 58346854 |
| Molecular Formula | C20H26ClFN2O3 |
| Molecular Weight | 396.89 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | ethyl 3-[3-[(2-chloro-4-fluorobenzoyl)amino]propyl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CCOC(=O)N1C2CCC1CC(CCCNC(=O)c1ccc(F)cc1Cl)C2 |
| InChI | InChI=1S/C20H26ClFN2O3/c1-2-27-20(26)24-15-6-7-16(24)11-13(10-15)4-3-9-23-19(25)17-8-5-14(22)12-18(17)21/h5,8,12-13,15-16H,2-4,6-7,9-11H2,1H3,(H,23,25) |
| InChIKey | CNLIDYJRPJRBQF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.89 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|