C15H20F2N2O2 — CID 63871300
N-[2-(4-aminocyclohexyl)oxyethyl]-3,4-difluorobenzamide (PubChem CID 63871300) has the molecular formula C15H20F2N2O2 and a molecular weight of 298.33 g/mol. Its IUPAC name is N-[2-(4-aminocyclohexyl)oxyethyl]-3,4-difluorobenzamide.
| Compound Name | N-[2-(4-aminocyclohexyl)oxyethyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 63871300 |
| Molecular Formula | C15H20F2N2O2 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | N-[2-(4-aminocyclohexyl)oxyethyl]-3,4-difluorobenzamide |
| SMILES | NC1CCC(OCCNC(=O)c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C15H20F2N2O2/c16-13-6-1-10(9-14(13)17)15(20)19-7-8-21-12-4-2-11(18)3-5-12/h1,6,9,11-12H,2-5,7-8,18H2,(H,19,20) |
| InChIKey | YROJBVFOLPPUIR-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|