C16H23ClN2O2 — CID 81316459
N-[2-(4-aminocyclohexyl)oxyethyl]-3-chloro-5-methylbenzamide (PubChem CID 81316459) has the molecular formula C16H23ClN2O2 and a molecular weight of 310.82 g/mol. Its IUPAC name is N-[2-(4-aminocyclohexyl)oxyethyl]-3-chloro-5-methylbenzamide.
| Compound Name | N-[2-(4-aminocyclohexyl)oxyethyl]-3-chloro-5-methylbenzamide |
|---|---|
| PubChem CID | 81316459 |
| Molecular Formula | C16H23ClN2O2 |
| Molecular Weight | 310.82 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | N-[2-(4-aminocyclohexyl)oxyethyl]-3-chloro-5-methylbenzamide |
| SMILES | Cc1cc(Cl)cc(C(=O)NCCOC2CCC(N)CC2)c1 |
| InChI | InChI=1S/C16H23ClN2O2/c1-11-8-12(10-13(17)9-11)16(20)19-6-7-21-15-4-2-14(18)3-5-15/h8-10,14-15H,2-7,18H2,1H3,(H,19,20) |
| InChIKey | HTNPAWJZNDJGIP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.82 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|