C14H18Cl2N2O2 — CID 82833373
4-amino-3,5-dichloro-N-(2-cyclopentyloxyethyl)benzamide (PubChem CID 82833373) has the molecular formula C14H18Cl2N2O2 and a molecular weight of 317.22 g/mol. Its IUPAC name is 4-amino-3,5-dichloro-N-(2-cyclopentyloxyethyl)benzamide.
| Compound Name | 4-amino-3,5-dichloro-N-(2-cyclopentyloxyethyl)benzamide |
|---|---|
| PubChem CID | 82833373 |
| Molecular Formula | C14H18Cl2N2O2 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 4-amino-3,5-dichloro-N-(2-cyclopentyloxyethyl)benzamide |
| SMILES | Nc1c(Cl)cc(C(=O)NCCOC2CCCC2)cc1Cl |
| InChI | InChI=1S/C14H18Cl2N2O2/c15-11-7-9(8-12(16)13(11)17)14(19)18-5-6-20-10-3-1-2-4-10/h7-8,10H,1-6,17H2,(H,18,19) |
| InChIKey | DPXKERQSHXLSLE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|