C11H13Cl2N3O3 — CID 103873774
4-amino-N-[2-(2-amino-2-oxoethoxy)ethyl]-3,5-dichlorobenzamide (PubChem CID 103873774) has the molecular formula C11H13Cl2N3O3 and a molecular weight of 306.15 g/mol. Its IUPAC name is 4-amino-N-[2-(2-amino-2-oxoethoxy)ethyl]-3,5-dichlorobenzamide.
| Compound Name | 4-amino-N-[2-(2-amino-2-oxoethoxy)ethyl]-3,5-dichlorobenzamide |
|---|---|
| PubChem CID | 103873774 |
| Molecular Formula | C11H13Cl2N3O3 |
| Molecular Weight | 306.15 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 4-amino-N-[2-(2-amino-2-oxoethoxy)ethyl]-3,5-dichlorobenzamide |
| SMILES | NC(=O)COCCNC(=O)c1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C11H13Cl2N3O3/c12-7-3-6(4-8(13)10(7)15)11(18)16-1-2-19-5-9(14)17/h3-4H,1-2,5,15H2,(H2,14,17)(H,16,18) |
| InChIKey | AIYTYDOTSCWIHM-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.15 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|