C13H16Cl2N2O2 — CID 103874570
4-amino-N-(2-but-3-enoxyethyl)-3,5-dichlorobenzamide (PubChem CID 103874570) has the molecular formula C13H16Cl2N2O2 and a molecular weight of 303.19 g/mol. Its IUPAC name is 4-amino-N-(2-but-3-enoxyethyl)-3,5-dichlorobenzamide.
| Compound Name | 4-amino-N-(2-but-3-enoxyethyl)-3,5-dichlorobenzamide |
|---|---|
| PubChem CID | 103874570 |
| Molecular Formula | C13H16Cl2N2O2 |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 4-amino-N-(2-but-3-enoxyethyl)-3,5-dichlorobenzamide |
| SMILES | C=CCCOCCNC(=O)c1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C13H16Cl2N2O2/c1-2-3-5-19-6-4-17-13(18)9-7-10(14)12(16)11(15)8-9/h2,7-8H,1,3-6,16H2,(H,17,18) |
| InChIKey | IXGKNVVVKLVATC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|