C13H15ClINO2 — CID 113339522
N-(2-but-3-enoxyethyl)-3-chloro-4-iodobenzamide (PubChem CID 113339522) has the molecular formula C13H15ClINO2 and a molecular weight of 379.63 g/mol. Its IUPAC name is N-(2-but-3-enoxyethyl)-3-chloro-4-iodobenzamide.
| Compound Name | N-(2-but-3-enoxyethyl)-3-chloro-4-iodobenzamide |
|---|---|
| PubChem CID | 113339522 |
| Molecular Formula | C13H15ClINO2 |
| Molecular Weight | 379.63 g/mol |
| Exact Mass | 378.98 |
| IUPAC Name | N-(2-but-3-enoxyethyl)-3-chloro-4-iodobenzamide |
| SMILES | C=CCCOCCNC(=O)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C13H15ClINO2/c1-2-3-7-18-8-6-16-13(17)10-4-5-12(15)11(14)9-10/h2,4-5,9H,1,3,6-8H2,(H,16,17) |
| InChIKey | FOIHUAHKCYTFIV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.63 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|