C14H19NO4 — CID 104938884
N-(2-cyclopentyloxyethyl)-3,5-dihydroxybenzamide (PubChem CID 104938884) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is N-(2-cyclopentyloxyethyl)-3,5-dihydroxybenzamide.
| Compound Name | N-(2-cyclopentyloxyethyl)-3,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 104938884 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | N-(2-cyclopentyloxyethyl)-3,5-dihydroxybenzamide |
| SMILES | O=C(NCCOC1CCCC1)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C14H19NO4/c16-11-7-10(8-12(17)9-11)14(18)15-5-6-19-13-3-1-2-4-13/h7-9,13,16-17H,1-6H2,(H,15,18) |
| InChIKey | XLOIAPBZWOKMHD-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|