C16H22N2O4 — CID 108538987
N-[2-(cyclohexanecarbonylamino)ethyl]-3,5-dihydroxybenzamide (PubChem CID 108538987) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is N-[2-(cyclohexanecarbonylamino)ethyl]-3,5-dihydroxybenzamide.
| Compound Name | N-[2-(cyclohexanecarbonylamino)ethyl]-3,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 108538987 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | N-[2-(cyclohexanecarbonylamino)ethyl]-3,5-dihydroxybenzamide |
| SMILES | O=C(NCCNC(=O)C1CCCCC1)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C16H22N2O4/c19-13-8-12(9-14(20)10-13)16(22)18-7-6-17-15(21)11-4-2-1-3-5-11/h8-11,19-20H,1-7H2,(H,17,21)(H,18,22) |
| InChIKey | FMGMZCXKBYQXBP-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|