C15H22N2O4 — CID 107704978
N-[2-(4-aminocyclohexyl)oxyethyl]-3,5-dihydroxybenzamide (PubChem CID 107704978) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is N-[2-(4-aminocyclohexyl)oxyethyl]-3,5-dihydroxybenzamide.
| Compound Name | N-[2-(4-aminocyclohexyl)oxyethyl]-3,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 107704978 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | N-[2-(4-aminocyclohexyl)oxyethyl]-3,5-dihydroxybenzamide |
| SMILES | NC1CCC(OCCNC(=O)c2cc(O)cc(O)c2)CC1 |
| InChI | InChI=1S/C15H22N2O4/c16-11-1-3-14(4-2-11)21-6-5-17-15(20)10-7-12(18)9-13(19)8-10/h7-9,11,14,18-19H,1-6,16H2,(H,17,20) |
| InChIKey | DWEKCTOHECXCDO-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|