C25H27ClF3N3O3 — CID 160599587
ethyl 2-[4-[[N'-[(4-chloro-2-fluorophenyl)methyl]-N-(3,4-difluorobenzoyl)carbamimidoyl]amino]cyclohexyl]acetate (PubChem CID 160599587) has the molecular formula C25H27ClF3N3O3 and a molecular weight of 509.96 g/mol. Its IUPAC name is ethyl 2-[4-[[N'-[(4-chloro-2-fluorophenyl)methyl]-N-(3,4-difluorobenzoyl)carbamimidoyl]amino]cyclohexyl]acetate.
| Compound Name | ethyl 2-[4-[[N'-[(4-chloro-2-fluorophenyl)methyl]-N-(3,4-difluorobenzoyl)carbamimidoyl]amino]cyclohexyl]acetate |
|---|---|
| PubChem CID | 160599587 |
| Molecular Formula | C25H27ClF3N3O3 |
| Molecular Weight | 509.96 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | ethyl 2-[4-[[N'-[(4-chloro-2-fluorophenyl)methyl]-N-(3,4-difluorobenzoyl)carbamimidoyl]amino]cyclohexyl]acetate |
| SMILES | CCOC(=O)CC1CCC(N/C(=N/Cc2ccc(Cl)cc2F)NC(=O)c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C25H27ClF3N3O3/c1-2-35-23(33)11-15-3-8-19(9-4-15)31-25(30-14-17-5-7-18(26)13-21(17)28)32-24(34)16-6-10-20(27)22(29)12-16/h5-7,10,12-13,15,19H,2-4,8-9,11,14H2,1H3,(H2,30,31,32,34) |
| InChIKey | RECBLXNJPACPGT-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.96 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|