C16H19ClF2O2 — CID 174866389
ethyl 2-[4-(4-chloro-2,3-difluorophenyl)cyclohexyl]acetate (PubChem CID 174866389) has the molecular formula C16H19ClF2O2 and a molecular weight of 316.78 g/mol. Its IUPAC name is ethyl 2-[4-(4-chloro-2,3-difluorophenyl)cyclohexyl]acetate.
| Compound Name | ethyl 2-[4-(4-chloro-2,3-difluorophenyl)cyclohexyl]acetate |
|---|---|
| PubChem CID | 174866389 |
| Molecular Formula | C16H19ClF2O2 |
| Molecular Weight | 316.78 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | ethyl 2-[4-(4-chloro-2,3-difluorophenyl)cyclohexyl]acetate |
| SMILES | CCOC(=O)CC1CCC(c2ccc(Cl)c(F)c2F)CC1 |
| InChI | InChI=1S/C16H19ClF2O2/c1-2-21-14(20)9-10-3-5-11(6-4-10)12-7-8-13(17)16(19)15(12)18/h7-8,10-11H,2-6,9H2,1H3 |
| InChIKey | IHEVQGHCYTXRPK-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.78 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|