C25H29ClF2N4O3 — CID 67966949
tert-butyl N-[4-[[(3-chloroanilino)-[(3,4-difluorobenzoyl)amino]methylidene]amino]cyclohexyl]carbamate (PubChem CID 67966949) has the molecular formula C25H29ClF2N4O3 and a molecular weight of 506.98 g/mol. Its IUPAC name is tert-butyl N-[4-[[(3-chloroanilino)-[(3,4-difluorobenzoyl)amino]methylidene]amino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[[(3-chloroanilino)-[(3,4-difluorobenzoyl)amino]methylidene]amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 67966949 |
| Molecular Formula | C25H29ClF2N4O3 |
| Molecular Weight | 506.98 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | tert-butyl N-[4-[[(3-chloroanilino)-[(3,4-difluorobenzoyl)amino]methylidene]amino]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(/N=C(\NC(=O)c2ccc(F)c(F)c2)Nc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C25H29ClF2N4O3/c1-25(2,3)35-24(34)31-18-10-8-17(9-11-18)29-23(30-19-6-4-5-16(26)14-19)32-22(33)15-7-12-20(27)21(28)13-15/h4-7,12-14,17-18H,8-11H2,1-3H3,(H,31,34)(H2,29,30,32,33) |
| InChIKey | CZEWDLQUWYXWOA-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.98 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|