C20H20ClFN4O3 — CID 57383113
methyl N-[3-[[[(4-chlorobenzoyl)amino]-(4-fluoroanilino)methylidene]amino]cyclobutyl]carbamate (PubChem CID 57383113) has the molecular formula C20H20ClFN4O3 and a molecular weight of 418.86 g/mol. Its IUPAC name is methyl N-[3-[[[(4-chlorobenzoyl)amino]-(4-fluoroanilino)methylidene]amino]cyclobutyl]carbamate.
| Compound Name | methyl N-[3-[[[(4-chlorobenzoyl)amino]-(4-fluoroanilino)methylidene]amino]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 57383113 |
| Molecular Formula | C20H20ClFN4O3 |
| Molecular Weight | 418.86 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | methyl N-[3-[[[(4-chlorobenzoyl)amino]-(4-fluoroanilino)methylidene]amino]cyclobutyl]carbamate |
| SMILES | COC(=O)NC1CC(/N=C(\NC(=O)c2ccc(Cl)cc2)Nc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C20H20ClFN4O3/c1-29-20(28)25-17-10-16(11-17)24-19(23-15-8-6-14(22)7-9-15)26-18(27)12-2-4-13(21)5-3-12/h2-9,16-17H,10-11H2,1H3,(H,25,28)(H2,23,24,26,27) |
| InChIKey | JILLTFLVBQAPMS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.86 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|