C24H24Cl2N6O — CID 57382980
4-chloro-N-[N-(3-chlorophenyl)-N'-[4-(pyrimidin-2-ylamino)cyclohexyl]carbamimidoyl]benzamide (PubChem CID 57382980) has the molecular formula C24H24Cl2N6O and a molecular weight of 483.40 g/mol. Its IUPAC name is 4-chloro-N-[N-(3-chlorophenyl)-N'-[4-(pyrimidin-2-ylamino)cyclohexyl]carbamimidoyl]benzamide.
| Compound Name | 4-chloro-N-[N-(3-chlorophenyl)-N'-[4-(pyrimidin-2-ylamino)cyclohexyl]carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 57382980 |
| Molecular Formula | C24H24Cl2N6O |
| Molecular Weight | 483.40 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | 4-chloro-N-[N-(3-chlorophenyl)-N'-[4-(pyrimidin-2-ylamino)cyclohexyl]carbamimidoyl]benzamide |
| SMILES | O=C(N/C(=N\C1CCC(Nc2ncccn2)CC1)Nc1cccc(Cl)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H24Cl2N6O/c25-17-7-5-16(6-8-17)22(33)32-24(31-21-4-1-3-18(26)15-21)30-20-11-9-19(10-12-20)29-23-27-13-2-14-28-23/h1-8,13-15,19-20H,9-12H2,(H,27,28,29)(H2,30,31,32,33) |
| InChIKey | YIHUHJKHXRCOKD-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 91.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.40 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|