C27H26ClF2N5O2 — CID 67966965
N-[4-[[(3-chloroanilino)-[(3,4-difluorobenzoyl)amino]methylidene]amino]cyclohexyl]-2-methylpyridine-4-carboxamide (PubChem CID 67966965) has the molecular formula C27H26ClF2N5O2 and a molecular weight of 525.99 g/mol. Its IUPAC name is N-[4-[[(3-chloroanilino)-[(3,4-difluorobenzoyl)amino]methylidene]amino]cyclohexyl]-2-methylpyridine-4-carboxamide.
| Compound Name | N-[4-[[(3-chloroanilino)-[(3,4-difluorobenzoyl)amino]methylidene]amino]cyclohexyl]-2-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 67966965 |
| Molecular Formula | C27H26ClF2N5O2 |
| Molecular Weight | 525.99 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | N-[4-[[(3-chloroanilino)-[(3,4-difluorobenzoyl)amino]methylidene]amino]cyclohexyl]-2-methylpyridine-4-carboxamide |
| SMILES | Cc1cc(C(=O)NC2CCC(/N=C(\NC(=O)c3ccc(F)c(F)c3)Nc3cccc(Cl)c3)CC2)ccn1 |
| InChI | InChI=1S/C27H26ClF2N5O2/c1-16-13-18(11-12-31-16)25(36)32-20-6-8-21(9-7-20)33-27(34-22-4-2-3-19(28)15-22)35-26(37)17-5-10-23(29)24(30)14-17/h2-5,10-15,20-21H,6-9H2,1H3,(H,32,36)(H2,33,34,35,37) |
| InChIKey | SGHPJADRMPDNQW-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.99 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|