C24H26F4N4O3 — CID 67966843
ethyl N-[4-[[N-(3,4-difluorobenzoyl)-N'-[(3,4-difluorophenyl)methyl]carbamimidoyl]amino]cyclohexyl]carbamate (PubChem CID 67966843) has the molecular formula C24H26F4N4O3 and a molecular weight of 494.49 g/mol. Its IUPAC name is ethyl N-[4-[[N-(3,4-difluorobenzoyl)-N'-[(3,4-difluorophenyl)methyl]carbamimidoyl]amino]cyclohexyl]carbamate.
| Compound Name | ethyl N-[4-[[N-(3,4-difluorobenzoyl)-N'-[(3,4-difluorophenyl)methyl]carbamimidoyl]amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 67966843 |
| Molecular Formula | C24H26F4N4O3 |
| Molecular Weight | 494.49 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | ethyl N-[4-[[N-(3,4-difluorobenzoyl)-N'-[(3,4-difluorophenyl)methyl]carbamimidoyl]amino]cyclohexyl]carbamate |
| SMILES | CCOC(=O)NC1CCC(N/C(=N/Cc2ccc(F)c(F)c2)NC(=O)c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C24H26F4N4O3/c1-2-35-24(34)31-17-7-5-16(6-8-17)30-23(29-13-14-3-9-18(25)20(27)11-14)32-22(33)15-4-10-19(26)21(28)12-15/h3-4,9-12,16-17H,2,5-8,13H2,1H3,(H,31,34)(H2,29,30,32,33) |
| InChIKey | WSBSCJGYCWKPOV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.49 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|