C25H27F4N3O3 — CID 153035985
ethyl 2-[4-[[N-(3,4-difluorobenzoyl)-N'-[(2,3-difluorophenyl)methyl]carbamimidoyl]amino]cyclohexyl]acetate (PubChem CID 153035985) has the molecular formula C25H27F4N3O3 and a molecular weight of 493.50 g/mol. Its IUPAC name is ethyl 2-[4-[[N-(3,4-difluorobenzoyl)-N'-[(2,3-difluorophenyl)methyl]carbamimidoyl]amino]cyclohexyl]acetate.
| Compound Name | ethyl 2-[4-[[N-(3,4-difluorobenzoyl)-N'-[(2,3-difluorophenyl)methyl]carbamimidoyl]amino]cyclohexyl]acetate |
|---|---|
| PubChem CID | 153035985 |
| Molecular Formula | C25H27F4N3O3 |
| Molecular Weight | 493.50 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | ethyl 2-[4-[[N-(3,4-difluorobenzoyl)-N'-[(2,3-difluorophenyl)methyl]carbamimidoyl]amino]cyclohexyl]acetate |
| SMILES | CCOC(=O)CC1CCC(N/C(=N/Cc2cccc(F)c2F)NC(=O)c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C25H27F4N3O3/c1-2-35-22(33)12-15-6-9-18(10-7-15)31-25(30-14-17-4-3-5-20(27)23(17)29)32-24(34)16-8-11-19(26)21(28)13-16/h3-5,8,11,13,15,18H,2,6-7,9-10,12,14H2,1H3,(H2,30,31,32,34) |
| InChIKey | VETFXAAJIKHPDS-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.50 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|