C24H28F4N4O2 — CID 123498316
ethyl N-[4-[[N-[(2,4-difluorophenyl)methyl]-N'-[(3,4-difluorophenyl)methyl]carbamimidoyl]amino]cyclohexyl]carbamate (PubChem CID 123498316) has the molecular formula C24H28F4N4O2 and a molecular weight of 480.51 g/mol. Its IUPAC name is ethyl N-[4-[[N-[(2,4-difluorophenyl)methyl]-N'-[(3,4-difluorophenyl)methyl]carbamimidoyl]amino]cyclohexyl]carbamate.
| Compound Name | ethyl N-[4-[[N-[(2,4-difluorophenyl)methyl]-N'-[(3,4-difluorophenyl)methyl]carbamimidoyl]amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 123498316 |
| Molecular Formula | C24H28F4N4O2 |
| Molecular Weight | 480.51 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | ethyl N-[4-[[N-[(2,4-difluorophenyl)methyl]-N'-[(3,4-difluorophenyl)methyl]carbamimidoyl]amino]cyclohexyl]carbamate |
| SMILES | CCOC(=O)NC1CCC(N/C(=N/Cc2ccc(F)c(F)c2)NCc2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C24H28F4N4O2/c1-2-34-24(33)32-19-8-6-18(7-9-19)31-23(29-13-15-3-10-20(26)22(28)11-15)30-14-16-4-5-17(25)12-21(16)27/h3-5,10-12,18-19H,2,6-9,13-14H2,1H3,(H,32,33)(H2,29,30,31) |
| InChIKey | CJCJJTUHJGVIHC-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.51 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|