C30H36ClF5N4O — CID 139354641
N-[N'-[3-amino-4,4,4-trifluoro-2-methyl-1-(2-pentylcyclohex-2-en-1-yl)butyl]-N-(3-chlorophenyl)carbamimidoyl]-3,4-difluorobenzamide (PubChem CID 139354641) has the molecular formula C30H36ClF5N4O and a molecular weight of 599.09 g/mol. Its IUPAC name is N-[N'-[3-amino-4,4,4-trifluoro-2-methyl-1-(2-pentylcyclohex-2-en-1-yl)butyl]-N-(3-chlorophenyl)carbamimidoyl]-3,4-difluorobenzamide.
| Compound Name | N-[N'-[3-amino-4,4,4-trifluoro-2-methyl-1-(2-pentylcyclohex-2-en-1-yl)butyl]-N-(3-chlorophenyl)carbamimidoyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 139354641 |
| Molecular Formula | C30H36ClF5N4O |
| Molecular Weight | 599.09 g/mol |
| Exact Mass | 598.25 |
| IUPAC Name | N-[N'-[3-amino-4,4,4-trifluoro-2-methyl-1-(2-pentylcyclohex-2-en-1-yl)butyl]-N-(3-chlorophenyl)carbamimidoyl]-3,4-difluorobenzamide |
| SMILES | CCCCCC1=CCCCC1C(/N=C(\NC(=O)c1ccc(F)c(F)c1)Nc1cccc(Cl)c1)C(C)C(N)C(F)(F)F |
| InChI | InChI=1S/C30H36ClF5N4O/c1-3-4-5-9-19-10-6-7-13-23(19)26(18(2)27(37)30(34,35)36)39-29(38-22-12-8-11-21(31)17-22)40-28(41)20-14-15-24(32)25(33)16-20/h8,10-12,14-18,23,26-27H,3-7,9,13,37H2,1-2H3,(H2,38,39,40,41) |
| InChIKey | WVBCDSSAZXDXSO-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.09 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|