C14H18Cl2FN — CID 114146496
1-(4-chlorocyclohexyl)-N-[(4-chloro-2-fluorophenyl)methyl]methanamine (PubChem CID 114146496) has the molecular formula C14H18Cl2FN and a molecular weight of 290.21 g/mol. Its IUPAC name is 1-(4-chlorocyclohexyl)-N-[(4-chloro-2-fluorophenyl)methyl]methanamine.
| Compound Name | 1-(4-chlorocyclohexyl)-N-[(4-chloro-2-fluorophenyl)methyl]methanamine |
|---|---|
| PubChem CID | 114146496 |
| Molecular Formula | C14H18Cl2FN |
| Molecular Weight | 290.21 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 1-(4-chlorocyclohexyl)-N-[(4-chloro-2-fluorophenyl)methyl]methanamine |
| SMILES | Fc1cc(Cl)ccc1CNCC1CCC(Cl)CC1 |
| InChI | InChI=1S/C14H18Cl2FN/c15-12-4-1-10(2-5-12)8-18-9-11-3-6-13(16)7-14(11)17/h3,6-7,10,12,18H,1-2,4-5,8-9H2 |
| InChIKey | OZSKYVVDHIAULX-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.21 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|