C20H15F3N4O2 — CID 141343912
N-[N-(5-hydroxy-3-pyridinyl)-N'-[3-(trifluoromethyl)phenyl]carbamimidoyl]benzamide (PubChem CID 141343912) has the molecular formula C20H15F3N4O2 and a molecular weight of 400.36 g/mol. Its IUPAC name is N-[N-(5-hydroxy-3-pyridinyl)-N'-[3-(trifluoromethyl)phenyl]carbamimidoyl]benzamide.
| Compound Name | N-[N-(5-hydroxy-3-pyridinyl)-N'-[3-(trifluoromethyl)phenyl]carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 141343912 |
| Molecular Formula | C20H15F3N4O2 |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | N-[N-(5-hydroxy-3-pyridinyl)-N'-[3-(trifluoromethyl)phenyl]carbamimidoyl]benzamide |
| SMILES | O=C(N/C(=N\c1cccc(C(F)(F)F)c1)Nc1cncc(O)c1)c1ccccc1 |
| InChI | InChI=1S/C20H15F3N4O2/c21-20(22,23)14-7-4-8-15(9-14)25-19(26-16-10-17(28)12-24-11-16)27-18(29)13-5-2-1-3-6-13/h1-12,28H,(H2,25,26,27,29) |
| InChIKey | SEGQFEOYBYDCOA-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|