C20H19F2N5O — CID 72944196
N-[N'-cyclopentyl-N-(6-fluoro-1H-indazol-3-yl)carbamimidoyl]-4-fluorobenzamide (PubChem CID 72944196) has the molecular formula C20H19F2N5O and a molecular weight of 383.40 g/mol. Its IUPAC name is N-[N'-cyclopentyl-N-(6-fluoro-1H-indazol-3-yl)carbamimidoyl]-4-fluorobenzamide.
| Compound Name | N-[N'-cyclopentyl-N-(6-fluoro-1H-indazol-3-yl)carbamimidoyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 72944196 |
| Molecular Formula | C20H19F2N5O |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | N-[N'-cyclopentyl-N-(6-fluoro-1H-indazol-3-yl)carbamimidoyl]-4-fluorobenzamide |
| SMILES | O=C(N/C(=N\C1CCCC1)Nc1n[nH]c2cc(F)ccc12)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H19F2N5O/c21-13-7-5-12(6-8-13)19(28)25-20(23-15-3-1-2-4-15)24-18-16-10-9-14(22)11-17(16)26-27-18/h5-11,15H,1-4H2,(H3,23,24,25,26,27,28) |
| InChIKey | BUFDQOROHMPCKV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|