C24H25F2N5O — CID 57383077
3-fluoro-N-[N-[5-(4-fluorophenyl)-1H-pyrazol-3-yl]-N'-(4-methylcyclohexyl)carbamimidoyl]benzamide (PubChem CID 57383077) has the molecular formula C24H25F2N5O and a molecular weight of 437.49 g/mol. Its IUPAC name is 3-fluoro-N-[N-[5-(4-fluorophenyl)-1H-pyrazol-3-yl]-N'-(4-methylcyclohexyl)carbamimidoyl]benzamide.
| Compound Name | 3-fluoro-N-[N-[5-(4-fluorophenyl)-1H-pyrazol-3-yl]-N'-(4-methylcyclohexyl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 57383077 |
| Molecular Formula | C24H25F2N5O |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 3-fluoro-N-[N-[5-(4-fluorophenyl)-1H-pyrazol-3-yl]-N'-(4-methylcyclohexyl)carbamimidoyl]benzamide |
| SMILES | CC1CCC(/N=C(\NC(=O)c2cccc(F)c2)Nc2cc(-c3ccc(F)cc3)[nH]n2)CC1 |
| InChI | InChI=1S/C24H25F2N5O/c1-15-5-11-20(12-6-15)27-24(29-23(32)17-3-2-4-19(26)13-17)28-22-14-21(30-31-22)16-7-9-18(25)10-8-16/h2-4,7-10,13-15,20H,5-6,11-12H2,1H3,(H3,27,28,29,30,31,32) |
| InChIKey | YOAQFZQQYSNGCO-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|