C23H23F2N5O2 — CID 123535289
3-fluoro-N-[N-[5-(4-fluorophenyl)-1H-pyrazol-3-yl]-N'-[(2-methyloxolan-2-yl)methyl]carbamimidoyl]benzamide (PubChem CID 123535289) has the molecular formula C23H23F2N5O2 and a molecular weight of 439.47 g/mol. Its IUPAC name is 3-fluoro-N-[N-[5-(4-fluorophenyl)-1H-pyrazol-3-yl]-N'-[(2-methyloxolan-2-yl)methyl]carbamimidoyl]benzamide.
| Compound Name | 3-fluoro-N-[N-[5-(4-fluorophenyl)-1H-pyrazol-3-yl]-N'-[(2-methyloxolan-2-yl)methyl]carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 123535289 |
| Molecular Formula | C23H23F2N5O2 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 3-fluoro-N-[N-[5-(4-fluorophenyl)-1H-pyrazol-3-yl]-N'-[(2-methyloxolan-2-yl)methyl]carbamimidoyl]benzamide |
| SMILES | CC1(C/N=C(\NC(=O)c2cccc(F)c2)Nc2cc(-c3ccc(F)cc3)[nH]n2)CCCO1 |
| InChI | InChI=1S/C23H23F2N5O2/c1-23(10-3-11-32-23)14-26-22(28-21(31)16-4-2-5-18(25)12-16)27-20-13-19(29-30-20)15-6-8-17(24)9-7-15/h2,4-9,12-13H,3,10-11,14H2,1H3,(H3,26,27,28,29,30,31) |
| InChIKey | UESODDRXWQZUQZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|