C24H26FN3O3 — CID 91634958
1-ethyl-5-[(3-fluorobenzoyl)amino]-N-[(2-methyloxolan-2-yl)methyl]indole-2-carboxamide (PubChem CID 91634958) has the molecular formula C24H26FN3O3 and a molecular weight of 423.49 g/mol. Its IUPAC name is 1-ethyl-5-[(3-fluorobenzoyl)amino]-N-[(2-methyloxolan-2-yl)methyl]indole-2-carboxamide.
| Compound Name | 1-ethyl-5-[(3-fluorobenzoyl)amino]-N-[(2-methyloxolan-2-yl)methyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 91634958 |
| Molecular Formula | C24H26FN3O3 |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 1-ethyl-5-[(3-fluorobenzoyl)amino]-N-[(2-methyloxolan-2-yl)methyl]indole-2-carboxamide |
| SMILES | CCn1c(C(=O)NCC2(C)CCCO2)cc2cc(NC(=O)c3cccc(F)c3)ccc21 |
| InChI | InChI=1S/C24H26FN3O3/c1-3-28-20-9-8-19(27-22(29)16-6-4-7-18(25)12-16)13-17(20)14-21(28)23(30)26-15-24(2)10-5-11-31-24/h4,6-9,12-14H,3,5,10-11,15H2,1-2H3,(H,26,30)(H,27,29) |
| InChIKey | ZZNUHHZTUFWSGC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |