C24H27N3O3 — CID 83279407
5-acetamido-1-benzyl-N-[(2-methyloxolan-2-yl)methyl]indole-2-carboxamide (PubChem CID 83279407) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is 5-acetamido-1-benzyl-N-[(2-methyloxolan-2-yl)methyl]indole-2-carboxamide.
| Compound Name | 5-acetamido-1-benzyl-N-[(2-methyloxolan-2-yl)methyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 83279407 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 5-acetamido-1-benzyl-N-[(2-methyloxolan-2-yl)methyl]indole-2-carboxamide |
| SMILES | CC(=O)Nc1ccc2c(c1)cc(C(=O)NCC1(C)CCCO1)n2Cc1ccccc1 |
| InChI | InChI=1S/C24H27N3O3/c1-17(28)26-20-9-10-21-19(13-20)14-22(27(21)15-18-7-4-3-5-8-18)23(29)25-16-24(2)11-6-12-30-24/h3-5,7-10,13-14H,6,11-12,15-16H2,1-2H3,(H,25,29)(H,26,28) |
| InChIKey | BSHFKOOFPPZGGU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |