C28H36N4O2 — CID 91635112
N-[1-[(4-tert-butylphenyl)methyl]-2-(4-ethylpiperazine-1-carbonyl)indol-5-yl]acetamide (PubChem CID 91635112) has the molecular formula C28H36N4O2 and a molecular weight of 460.62 g/mol. Its IUPAC name is N-[1-[(4-tert-butylphenyl)methyl]-2-(4-ethylpiperazine-1-carbonyl)indol-5-yl]acetamide.
| Compound Name | N-[1-[(4-tert-butylphenyl)methyl]-2-(4-ethylpiperazine-1-carbonyl)indol-5-yl]acetamide |
|---|---|
| PubChem CID | 91635112 |
| Molecular Formula | C28H36N4O2 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | N-[1-[(4-tert-butylphenyl)methyl]-2-(4-ethylpiperazine-1-carbonyl)indol-5-yl]acetamide |
| SMILES | CCN1CCN(C(=O)c2cc3cc(NC(C)=O)ccc3n2Cc2ccc(C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C28H36N4O2/c1-6-30-13-15-31(16-14-30)27(34)26-18-22-17-24(29-20(2)33)11-12-25(22)32(26)19-21-7-9-23(10-8-21)28(3,4)5/h7-12,17-18H,6,13-16,19H2,1-5H3,(H,29,33) |
| InChIKey | SGTRBTXQFSWRIY-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |