C29H37N3O2 — CID 83280162
4-tert-butyl-N-[1-(3-methylbutyl)-2-(pyrrolidine-1-carbonyl)indol-5-yl]benzamide (PubChem CID 83280162) has the molecular formula C29H37N3O2 and a molecular weight of 459.63 g/mol. Its IUPAC name is 4-tert-butyl-N-[1-(3-methylbutyl)-2-(pyrrolidine-1-carbonyl)indol-5-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[1-(3-methylbutyl)-2-(pyrrolidine-1-carbonyl)indol-5-yl]benzamide |
|---|---|
| PubChem CID | 83280162 |
| Molecular Formula | C29H37N3O2 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.29 |
| IUPAC Name | 4-tert-butyl-N-[1-(3-methylbutyl)-2-(pyrrolidine-1-carbonyl)indol-5-yl]benzamide |
| SMILES | CC(C)CCn1c(C(=O)N2CCCC2)cc2cc(NC(=O)c3ccc(C(C)(C)C)cc3)ccc21 |
| InChI | InChI=1S/C29H37N3O2/c1-20(2)14-17-32-25-13-12-24(18-22(25)19-26(32)28(34)31-15-6-7-16-31)30-27(33)21-8-10-23(11-9-21)29(3,4)5/h8-13,18-20H,6-7,14-17H2,1-5H3,(H,30,33) |
| InChIKey | RRUNIJKUGUPGAK-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |