C30H33N3O3S — CID 42808775
N-[1-benzyl-2-(pyrrolidine-1-carbonyl)indol-5-yl]-4-tert-butylbenzenesulfonamide (PubChem CID 42808775) has the molecular formula C30H33N3O3S and a molecular weight of 515.68 g/mol. Its IUPAC name is N-[1-benzyl-2-(pyrrolidine-1-carbonyl)indol-5-yl]-4-tert-butylbenzenesulfonamide.
| Compound Name | N-[1-benzyl-2-(pyrrolidine-1-carbonyl)indol-5-yl]-4-tert-butylbenzenesulfonamide |
|---|---|
| PubChem CID | 42808775 |
| Molecular Formula | C30H33N3O3S |
| Molecular Weight | 515.68 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | N-[1-benzyl-2-(pyrrolidine-1-carbonyl)indol-5-yl]-4-tert-butylbenzenesulfonamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc3c(c2)cc(C(=O)N2CCCC2)n3Cc2ccccc2)cc1 |
| InChI | InChI=1S/C30H33N3O3S/c1-30(2,3)24-11-14-26(15-12-24)37(35,36)31-25-13-16-27-23(19-25)20-28(29(34)32-17-7-8-18-32)33(27)21-22-9-5-4-6-10-22/h4-6,9-16,19-20,31H,7-8,17-18,21H2,1-3H3 |
| InChIKey | QWKBRHVDJKSGML-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.68 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |