C25H29N3O2 — CID 29140119
1-[4-(1-benzylindole-2-carbonyl)piperazin-1-yl]-2,2-dimethylpropan-1-one (PubChem CID 29140119) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is 1-[4-(1-benzylindole-2-carbonyl)piperazin-1-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[4-(1-benzylindole-2-carbonyl)piperazin-1-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 29140119 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 1-[4-(1-benzylindole-2-carbonyl)piperazin-1-yl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)N1CCN(C(=O)c2cc3ccccc3n2Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H29N3O2/c1-25(2,3)24(30)27-15-13-26(14-16-27)23(29)22-17-20-11-7-8-12-21(20)28(22)18-19-9-5-4-6-10-19/h4-12,17H,13-16,18H2,1-3H3 |
| InChIKey | AXWARYHSSVYNKO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |