C27H26FN3O3S — CID 55774194
(4-benzylsulfonylpiperazin-1-yl)-[1-[(2-fluorophenyl)methyl]indol-2-yl]methanone (PubChem CID 55774194) has the molecular formula C27H26FN3O3S and a molecular weight of 491.59 g/mol. Its IUPAC name is (4-benzylsulfonylpiperazin-1-yl)-[1-[(2-fluorophenyl)methyl]indol-2-yl]methanone.
| Compound Name | (4-benzylsulfonylpiperazin-1-yl)-[1-[(2-fluorophenyl)methyl]indol-2-yl]methanone |
|---|---|
| PubChem CID | 55774194 |
| Molecular Formula | C27H26FN3O3S |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | (4-benzylsulfonylpiperazin-1-yl)-[1-[(2-fluorophenyl)methyl]indol-2-yl]methanone |
| SMILES | O=C(c1cc2ccccc2n1Cc1ccccc1F)N1CCN(S(=O)(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H26FN3O3S/c28-24-12-6-4-11-23(24)19-31-25-13-7-5-10-22(25)18-26(31)27(32)29-14-16-30(17-15-29)35(33,34)20-21-8-2-1-3-9-21/h1-13,18H,14-17,19-20H2 |
| InChIKey | DPGOXPRMUZKWLI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |