C22H21FN2O4 — CID 119251843
1-[1-[(2-fluorophenyl)methyl]indole-2-carbonyl]-4-hydroxypiperidine-4-carboxylic acid (PubChem CID 119251843) has the molecular formula C22H21FN2O4 and a molecular weight of 396.42 g/mol. Its IUPAC name is 1-[1-[(2-fluorophenyl)methyl]indole-2-carbonyl]-4-hydroxypiperidine-4-carboxylic acid.
| Compound Name | 1-[1-[(2-fluorophenyl)methyl]indole-2-carbonyl]-4-hydroxypiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 119251843 |
| Molecular Formula | C22H21FN2O4 |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 1-[1-[(2-fluorophenyl)methyl]indole-2-carbonyl]-4-hydroxypiperidine-4-carboxylic acid |
| SMILES | O=C(c1cc2ccccc2n1Cc1ccccc1F)N1CCC(O)(C(=O)O)CC1 |
| InChI | InChI=1S/C22H21FN2O4/c23-17-7-3-1-6-16(17)14-25-18-8-4-2-5-15(18)13-19(25)20(26)24-11-9-22(29,10-12-24)21(27)28/h1-8,13,29H,9-12,14H2,(H,27,28) |
| InChIKey | VNGJXBNCIQZENN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 82.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |