C21H21FN2O3 — CID 56551042
propan-2-yl 2-[[1-[(2-fluorophenyl)methyl]indole-2-carbonyl]amino]acetate (PubChem CID 56551042) has the molecular formula C21H21FN2O3 and a molecular weight of 368.41 g/mol. Its IUPAC name is propan-2-yl 2-[[1-[(2-fluorophenyl)methyl]indole-2-carbonyl]amino]acetate.
| Compound Name | propan-2-yl 2-[[1-[(2-fluorophenyl)methyl]indole-2-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 56551042 |
| Molecular Formula | C21H21FN2O3 |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | propan-2-yl 2-[[1-[(2-fluorophenyl)methyl]indole-2-carbonyl]amino]acetate |
| SMILES | CC(C)OC(=O)CNC(=O)c1cc2ccccc2n1Cc1ccccc1F |
| InChI | InChI=1S/C21H21FN2O3/c1-14(2)27-20(25)12-23-21(26)19-11-15-7-4-6-10-18(15)24(19)13-16-8-3-5-9-17(16)22/h3-11,14H,12-13H2,1-2H3,(H,23,26) |
| InChIKey | HYEQFGCNCUPDCJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |