C19H22FN3O5S2 — CID 167988550
N-[2-(4-benzylsulfonylpiperazin-1-yl)-2-oxoethyl]-2-fluorobenzenesulfonamide (PubChem CID 167988550) has the molecular formula C19H22FN3O5S2 and a molecular weight of 455.53 g/mol. Its IUPAC name is N-[2-(4-benzylsulfonylpiperazin-1-yl)-2-oxoethyl]-2-fluorobenzenesulfonamide.
| Compound Name | N-[2-(4-benzylsulfonylpiperazin-1-yl)-2-oxoethyl]-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 167988550 |
| Molecular Formula | C19H22FN3O5S2 |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | N-[2-(4-benzylsulfonylpiperazin-1-yl)-2-oxoethyl]-2-fluorobenzenesulfonamide |
| SMILES | O=C(CNS(=O)(=O)c1ccccc1F)N1CCN(S(=O)(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H22FN3O5S2/c20-17-8-4-5-9-18(17)30(27,28)21-14-19(24)22-10-12-23(13-11-22)29(25,26)15-16-6-2-1-3-7-16/h1-9,21H,10-15H2 |
| InChIKey | NNKAOSZAIWVOMJ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |