C22H25N3O4S — CID 50802027
1-benzyl-N,N-dimethyl-2-(morpholine-4-carbonyl)indole-5-sulfonamide (PubChem CID 50802027) has the molecular formula C22H25N3O4S and a molecular weight of 427.53 g/mol. Its IUPAC name is 1-benzyl-N,N-dimethyl-2-(morpholine-4-carbonyl)indole-5-sulfonamide.
| Compound Name | 1-benzyl-N,N-dimethyl-2-(morpholine-4-carbonyl)indole-5-sulfonamide |
|---|---|
| PubChem CID | 50802027 |
| Molecular Formula | C22H25N3O4S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 1-benzyl-N,N-dimethyl-2-(morpholine-4-carbonyl)indole-5-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc2c(c1)cc(C(=O)N1CCOCC1)n2Cc1ccccc1 |
| InChI | InChI=1S/C22H25N3O4S/c1-23(2)30(27,28)19-8-9-20-18(14-19)15-21(22(26)24-10-12-29-13-11-24)25(20)16-17-6-4-3-5-7-17/h3-9,14-15H,10-13,16H2,1-2H3 |
| InChIKey | QMUXVIAJFYOJBC-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 71.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |