C24H24N4O3S — CID 50802080
1-benzyl-5-(dimethylsulfamoyl)-N-(pyridin-2-ylmethyl)indole-2-carboxamide (PubChem CID 50802080) has the molecular formula C24H24N4O3S and a molecular weight of 448.55 g/mol. Its IUPAC name is 1-benzyl-5-(dimethylsulfamoyl)-N-(pyridin-2-ylmethyl)indole-2-carboxamide.
| Compound Name | 1-benzyl-5-(dimethylsulfamoyl)-N-(pyridin-2-ylmethyl)indole-2-carboxamide |
|---|---|
| PubChem CID | 50802080 |
| Molecular Formula | C24H24N4O3S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 1-benzyl-5-(dimethylsulfamoyl)-N-(pyridin-2-ylmethyl)indole-2-carboxamide |
| SMILES | CN(C)S(=O)(=O)c1ccc2c(c1)cc(C(=O)NCc1ccccn1)n2Cc1ccccc1 |
| InChI | InChI=1S/C24H24N4O3S/c1-27(2)32(30,31)21-11-12-22-19(14-21)15-23(28(22)17-18-8-4-3-5-9-18)24(29)26-16-20-10-6-7-13-25-20/h3-15H,16-17H2,1-2H3,(H,26,29) |
| InChIKey | ZEAITLLGRBIFGI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |