C17H23N3O3S — CID 50801918
1-ethyl-N,N-dimethyl-2-(pyrrolidine-1-carbonyl)indole-5-sulfonamide (PubChem CID 50801918) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is 1-ethyl-N,N-dimethyl-2-(pyrrolidine-1-carbonyl)indole-5-sulfonamide.
| Compound Name | 1-ethyl-N,N-dimethyl-2-(pyrrolidine-1-carbonyl)indole-5-sulfonamide |
|---|---|
| PubChem CID | 50801918 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 1-ethyl-N,N-dimethyl-2-(pyrrolidine-1-carbonyl)indole-5-sulfonamide |
| SMILES | CCn1c(C(=O)N2CCCC2)cc2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C17H23N3O3S/c1-4-20-15-8-7-14(24(22,23)18(2)3)11-13(15)12-16(20)17(21)19-9-5-6-10-19/h7-8,11-12H,4-6,9-10H2,1-3H3 |
| InChIKey | BLTOJHWYTMOXCU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |