C14H18N2OS — CID 6619973
(4-ethylthieno[3,2-b]pyrrol-5-yl)-piperidin-1-ylmethanone (PubChem CID 6619973) has the molecular formula C14H18N2OS and a molecular weight of 262.38 g/mol. Its IUPAC name is (4-ethylthieno[3,2-b]pyrrol-5-yl)-piperidin-1-ylmethanone.
| Compound Name | (4-ethylthieno[3,2-b]pyrrol-5-yl)-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 6619973 |
| Molecular Formula | C14H18N2OS |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | (4-ethylthieno[3,2-b]pyrrol-5-yl)-piperidin-1-ylmethanone |
| SMILES | CCn1c(C(=O)N2CCCCC2)cc2sccc21 |
| InChI | InChI=1S/C14H18N2OS/c1-2-16-11-6-9-18-13(11)10-12(16)14(17)15-7-4-3-5-8-15/h6,9-10H,2-5,7-8H2,1H3 |
| InChIKey | XKBOHGHFENCUIG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |