C22H32N4O2S — CID 20883520
1-(4-ethylthieno[3,2-b]pyrrole-5-carbonyl)-N-(3-pyrrolidin-1-ylpropyl)piperidine-4-carboxamide (PubChem CID 20883520) has the molecular formula C22H32N4O2S and a molecular weight of 416.59 g/mol. Its IUPAC name is 1-(4-ethylthieno[3,2-b]pyrrole-5-carbonyl)-N-(3-pyrrolidin-1-ylpropyl)piperidine-4-carboxamide.
| Compound Name | 1-(4-ethylthieno[3,2-b]pyrrole-5-carbonyl)-N-(3-pyrrolidin-1-ylpropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20883520 |
| Molecular Formula | C22H32N4O2S |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 1-(4-ethylthieno[3,2-b]pyrrole-5-carbonyl)-N-(3-pyrrolidin-1-ylpropyl)piperidine-4-carboxamide |
| SMILES | CCn1c(C(=O)N2CCC(C(=O)NCCCN3CCCC3)CC2)cc2sccc21 |
| InChI | InChI=1S/C22H32N4O2S/c1-2-26-18-8-15-29-20(18)16-19(26)22(28)25-13-6-17(7-14-25)21(27)23-9-5-12-24-10-3-4-11-24/h8,15-17H,2-7,9-14H2,1H3,(H,23,27) |
| InChIKey | GZDXWDHUTXVHCJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|