C24H36N4O2S — CID 92667716
N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-1-(4-methylthieno[3,2-b]pyrrole-5-carbonyl)piperidine-4-carboxamide (PubChem CID 92667716) has the molecular formula C24H36N4O2S and a molecular weight of 444.65 g/mol. Its IUPAC name is N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-1-(4-methylthieno[3,2-b]pyrrole-5-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-1-(4-methylthieno[3,2-b]pyrrole-5-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 92667716 |
| Molecular Formula | C24H36N4O2S |
| Molecular Weight | 444.65 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-1-(4-methylthieno[3,2-b]pyrrole-5-carbonyl)piperidine-4-carboxamide |
| SMILES | C[C@@H]1C[C@@H](C)CN(CCCNC(=O)C2CCN(C(=O)c3cc4sccc4n3C)CC2)C1 |
| InChI | InChI=1S/C24H36N4O2S/c1-17-13-18(2)16-27(15-17)9-4-8-25-23(29)19-5-10-28(11-6-19)24(30)21-14-22-20(26(21)3)7-12-31-22/h7,12,14,17-19H,4-6,8-11,13,15-16H2,1-3H3,(H,25,29)/t17-,18-/m1/s1 |
| InChIKey | DHBODTMLNCWNLZ-QZTJIDSGSA-N |
| XLogP | 3.58 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.65 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|