C18H26ClN3OS — CID 122175883
2-chloro-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-4-methylthieno[3,2-b]pyrrole-5-carboxamide (PubChem CID 122175883) has the molecular formula C18H26ClN3OS and a molecular weight of 367.95 g/mol. Its IUPAC name is 2-chloro-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-4-methylthieno[3,2-b]pyrrole-5-carboxamide.
| Compound Name | 2-chloro-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-4-methylthieno[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 122175883 |
| Molecular Formula | C18H26ClN3OS |
| Molecular Weight | 367.95 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 2-chloro-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-4-methylthieno[3,2-b]pyrrole-5-carboxamide |
| SMILES | CC1CC(C)CN(CCCNC(=O)c2cc3sc(Cl)cc3n2C)C1 |
| InChI | InChI=1S/C18H26ClN3OS/c1-12-7-13(2)11-22(10-12)6-4-5-20-18(23)15-8-16-14(21(15)3)9-17(19)24-16/h8-9,12-13H,4-7,10-11H2,1-3H3,(H,20,23) |
| InChIKey | RRVMTIBNVWOIPH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.95 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|