C16H19ClN2OS — CID 122175911
2-chloro-N-[2-(cyclohexen-1-yl)ethyl]-4-methylthieno[3,2-b]pyrrole-5-carboxamide (PubChem CID 122175911) has the molecular formula C16H19ClN2OS and a molecular weight of 322.86 g/mol. Its IUPAC name is 2-chloro-N-[2-(cyclohexen-1-yl)ethyl]-4-methylthieno[3,2-b]pyrrole-5-carboxamide.
| Compound Name | 2-chloro-N-[2-(cyclohexen-1-yl)ethyl]-4-methylthieno[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 122175911 |
| Molecular Formula | C16H19ClN2OS |
| Molecular Weight | 322.86 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 2-chloro-N-[2-(cyclohexen-1-yl)ethyl]-4-methylthieno[3,2-b]pyrrole-5-carboxamide |
| SMILES | Cn1c(C(=O)NCCC2=CCCCC2)cc2sc(Cl)cc21 |
| InChI | InChI=1S/C16H19ClN2OS/c1-19-12-10-15(17)21-14(12)9-13(19)16(20)18-8-7-11-5-3-2-4-6-11/h5,9-10H,2-4,6-8H2,1H3,(H,18,20) |
| InChIKey | XUGPMQPRXLTRRR-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.86 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|