C22H29N3O2S — CID 122176166
N-[2-(cyclohexen-1-yl)ethyl]-1-(4-methylthieno[3,2-b]pyrrole-5-carbonyl)piperidine-3-carboxamide (PubChem CID 122176166) has the molecular formula C22H29N3O2S and a molecular weight of 399.56 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-1-(4-methylthieno[3,2-b]pyrrole-5-carbonyl)piperidine-3-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-1-(4-methylthieno[3,2-b]pyrrole-5-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 122176166 |
| Molecular Formula | C22H29N3O2S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-1-(4-methylthieno[3,2-b]pyrrole-5-carbonyl)piperidine-3-carboxamide |
| SMILES | Cn1c(C(=O)N2CCCC(C(=O)NCCC3=CCCCC3)C2)cc2sccc21 |
| InChI | InChI=1S/C22H29N3O2S/c1-24-18-10-13-28-20(18)14-19(24)22(27)25-12-5-8-17(15-25)21(26)23-11-9-16-6-3-2-4-7-16/h6,10,13-14,17H,2-5,7-9,11-12,15H2,1H3,(H,23,26) |
| InChIKey | DUZQLCPQNJMTKJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|