C21H24ClN3OS — CID 20877211
2-chloro-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-4-ethylthieno[3,2-b]pyrrole-5-carboxamide (PubChem CID 20877211) has the molecular formula C21H24ClN3OS and a molecular weight of 401.96 g/mol. Its IUPAC name is 2-chloro-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-4-ethylthieno[3,2-b]pyrrole-5-carboxamide.
| Compound Name | 2-chloro-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-4-ethylthieno[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 20877211 |
| Molecular Formula | C21H24ClN3OS |
| Molecular Weight | 401.96 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 2-chloro-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-4-ethylthieno[3,2-b]pyrrole-5-carboxamide |
| SMILES | CCn1c(C(=O)NCCCN2CCc3ccccc3C2)cc2sc(Cl)cc21 |
| InChI | InChI=1S/C21H24ClN3OS/c1-2-25-17-13-20(22)27-19(17)12-18(25)21(26)23-9-5-10-24-11-8-15-6-3-4-7-16(15)14-24/h3-4,6-7,12-13H,2,5,8-11,14H2,1H3,(H,23,26) |
| InChIKey | ZFZOTGXSSAKNAI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.96 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|